C25H42N4O3S2 — CID 129018779
(7Z,16E)-7-ethylidene-6-methylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,9-dione (PubChem CID 129018779) has the molecular formula C25H42N4O3S2 and a molecular weight of 510.77 g/mol. Its IUPAC name is (7Z,16E)-7-ethylidene-6-methylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,9-dione.
| Compound Name | (7Z,16E)-7-ethylidene-6-methylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,9-dione |
|---|---|
| PubChem CID | 129018779 |
| Molecular Formula | C25H42N4O3S2 |
| Molecular Weight | 510.77 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | (7Z,16E)-7-ethylidene-6-methylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,9-dione |
| SMILES | C=C1NC(C(C)C)C(=O)OC2/C=C/CCSSCC(NCC(C(C)C)NCC2)C(=O)N/C1=C\C |
| InChI | InChI=1S/C25H42N4O3S2/c1-7-20-18(6)28-23(17(4)5)25(31)32-19-10-8-9-13-33-34-15-22(24(30)29-20)27-14-21(16(2)3)26-12-11-19/h7-8,10,16-17,19,21-23,26-28H,6,9,11-15H2,1-5H3,(H,29,30)/b10-8+,20-7- |
| InChIKey | OZGHXWRJPSBLME-MWAQTIKRSA-N |
| XLogP | 3.36 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|