C21H36S — CID 129018950
3-ethylsulfanyl-5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1,1-dipropylcyclohexane (PubChem CID 129018950) has the molecular formula C21H36S and a molecular weight of 320.59 g/mol. Its IUPAC name is 3-ethylsulfanyl-5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1,1-dipropylcyclohexane.
| Compound Name | 3-ethylsulfanyl-5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1,1-dipropylcyclohexane |
|---|---|
| PubChem CID | 129018950 |
| Molecular Formula | C21H36S |
| Molecular Weight | 320.59 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 3-ethylsulfanyl-5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1,1-dipropylcyclohexane |
| SMILES | C=C/C=C\C=C(/C)C1CC(SCC)CC(CCC)(CCC)C1 |
| InChI | InChI=1S/C21H36S/c1-6-10-11-12-18(5)19-15-20(22-9-4)17-21(16-19,13-7-2)14-8-3/h6,10-12,19-20H,1,7-9,13-17H2,2-5H3/b11-10-,18-12+ |
| InChIKey | VLJYBLJMOMBITI-RDWZXGDNSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.59 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|