About 2-propan-2-yl-5,6-dihydro-1H-benzimidazole
2-propan-2-yl-5,6-dihydro-1H-benzimidazole (PubChem CID 129018981) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-propan-2-yl-5,6-dihydro-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-propan-2-yl-5,6-dihydro-1H-benzimidazole |
| PubChem CID | 129018981 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-propan-2-yl-5,6-dihydro-1H-benzimidazole |
| SMILES | CC(C)c1nc2c([nH]1)=CCCC=2 |
| InChI | InChI=1S/C10H14N2/c1-7(2)10-11-8-5-3-4-6-9(8)12-10/h5-7H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | PNEWMSBHWFIQDE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propan-2-yl-5,6-dihydro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-5,6-dihydro-1H-benzimidazole?
The IUPAC name of 2-propan-2-yl-5,6-dihydro-1H-benzimidazole (CID 129018981) is 2-propan-2-yl-5,6-dihydro-1H-benzimidazole.
What is the SMILES notation for 2-propan-2-yl-5,6-dihydro-1H-benzimidazole?
The canonical SMILES for 2-propan-2-yl-5,6-dihydro-1H-benzimidazole is CC(C)c1nc2c([nH]1)=CCCC=2.
What is the InChIKey of 2-propan-2-yl-5,6-dihydro-1H-benzimidazole?
The InChIKey is PNEWMSBHWFIQDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-7(2)10-11-8-5-3-4-6-9(8)12-10/h5-7H,3-4H2,1-2H3,(H,11,12).
What are the key properties of 2-propan-2-yl-5,6-dihydro-1H-benzimidazole?
2-propan-2-yl-5,6-dihydro-1H-benzimidazole has a molecular weight of 162.24 g/mol, XLogP of 0.89, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-5,6-dihydro-1H-benzimidazole is sourced from PubChem (CID 129018981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).