C33H51N — CID 129019035
5-cyclohepta-1,4,6-trien-1-yl-N-ethyl-3-[(5E,6Z)-5-ethylidene-7,9-dimethyl-4-methylidenedeca-6,9-dienyl]-3-propylcyclohexan-1-amine (PubChem CID 129019035) has the molecular formula C33H51N and a molecular weight of 461.78 g/mol. Its IUPAC name is 5-cyclohepta-1,4,6-trien-1-yl-N-ethyl-3-[(5E,6Z)-5-ethylidene-7,9-dimethyl-4-methylidenedeca-6,9-dienyl]-3-propylcyclohexan-1-amine.
| Compound Name | 5-cyclohepta-1,4,6-trien-1-yl-N-ethyl-3-[(5E,6Z)-5-ethylidene-7,9-dimethyl-4-methylidenedeca-6,9-dienyl]-3-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 129019035 |
| Molecular Formula | C33H51N |
| Molecular Weight | 461.78 g/mol |
| Exact Mass | 461.40 |
| IUPAC Name | 5-cyclohepta-1,4,6-trien-1-yl-N-ethyl-3-[(5E,6Z)-5-ethylidene-7,9-dimethyl-4-methylidenedeca-6,9-dienyl]-3-propylcyclohexan-1-amine |
| SMILES | C=C(C)C/C(C)=C\C(=C/C)C(=C)CCCC1(CCC)CC(NCC)CC(C2=CCC=CC=C2)C1 |
| InChI | InChI=1S/C33H51N/c1-8-19-33(20-15-16-28(7)29(9-2)22-27(6)21-26(4)5)24-31(23-32(25-33)34-10-3)30-17-13-11-12-14-18-30/h9,11-13,17-18,22,31-32,34H,4,7-8,10,14-16,19-21,23-25H2,1-3,5-6H3/b27-22-,29-9+ |
| InChIKey | VNDOJCSBOAMBRE-XXDSKVFBSA-N |
| XLogP | 9.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.78 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|