C19H33N — CID 129019219
N-ethyl-5-[(2Z,4Z)-hepta-2,4,6-trien-3-yl]-3-methyl-3-propylcyclohexan-1-amine (PubChem CID 129019219) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is N-ethyl-5-[(2Z,4Z)-hepta-2,4,6-trien-3-yl]-3-methyl-3-propylcyclohexan-1-amine.
| Compound Name | N-ethyl-5-[(2Z,4Z)-hepta-2,4,6-trien-3-yl]-3-methyl-3-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 129019219 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | N-ethyl-5-[(2Z,4Z)-hepta-2,4,6-trien-3-yl]-3-methyl-3-propylcyclohexan-1-amine |
| SMILES | C=C/C=C\C(=C/C)C1CC(NCC)CC(C)(CCC)C1 |
| InChI | InChI=1S/C19H33N/c1-6-10-11-16(8-3)17-13-18(20-9-4)15-19(5,14-17)12-7-2/h6,8,10-11,17-18,20H,1,7,9,12-15H2,2-5H3/b11-10-,16-8+ |
| InChIKey | QGLXFZCJEPBFPV-TZINGHKZSA-N |
| XLogP | 5.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|