About CID 129019421
CID 129019421 (PubChem CID 129019421) has the molecular formula C25H27FNO2P
and a molecular weight of 423.47 g/mol.
Molecular Properties
| Compound Name | CID 129019421 |
| PubChem CID | 129019421 |
| Molecular Formula | C25H27FNO2P |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | — |
| SMILES | C=[P+]([O-])C[C@@H]1CCC[C@H](n2cc(Cc3ccc(C4CC4)cc3)c3c(F)cccc32)O1 |
| InChI | InChI=1S/C25H27FNO2P/c1-30(28)16-21-4-2-7-24(29-21)27-15-20(25-22(26)5-3-6-23(25)27)14-17-8-10-18(11-9-17)19-12-13-19/h3,5-6,8-11,15,19,21,24H,1-2,4,7,12-14,16H2/t21-,24+/m0/s1 |
| InChIKey | ZPGRLOWQWOWGCQ-XUZZJYLKSA-N |
| XLogP | 5.51 |
| TPSA | 37.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 129019421 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 129019421?
The IUPAC name of CID 129019421 (CID 129019421) is not available.
What is the SMILES notation for CID 129019421?
The canonical SMILES for CID 129019421 is C=[P+]([O-])C[C@@H]1CCC[C@H](n2cc(Cc3ccc(C4CC4)cc3)c3c(F)cccc32)O1.
What is the InChIKey of CID 129019421?
The InChIKey is ZPGRLOWQWOWGCQ-XUZZJYLKSA-N. The full InChI is InChI=1S/C25H27FNO2P/c1-30(28)16-21-4-2-7-24(29-21)27-15-20(25-22(26)5-3-6-23(25)27)14-17-8-10-18(11-9-17)19-12-13-19/h3,5-6,8-11,15,19,21,24H,1-2,4,7,12-14,16H2/t21-,24+/m0/s1.
What are the key properties of CID 129019421?
CID 129019421 has a molecular weight of 423.47 g/mol, XLogP of 5.51, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 129019421 is sourced from PubChem (CID 129019421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).