About 2,4,6-tritert-butylphenol
2,4,6-tritert-butylphenol (PubChem CID 12902) has the molecular formula C18H30O
and a molecular weight of 262.44 g/mol. Its IUPAC name is 2,4,6-tritert-butylphenol.
Molecular Properties
| Compound Name | 2,4,6-tritert-butylphenol |
| PubChem CID | 12902 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 2,4,6-tritert-butylphenol |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H30O/c1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)18(7,8)9/h10-11,19H,1-9H3 |
| InChIKey | PFEFOYRSMXVNEL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4,6-tritert-butylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-tritert-butylphenol?
The IUPAC name of 2,4,6-tritert-butylphenol (CID 12902) is 2,4,6-tritert-butylphenol.
What is the SMILES notation for 2,4,6-tritert-butylphenol?
The canonical SMILES for 2,4,6-tritert-butylphenol is CC(C)(C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2,4,6-tritert-butylphenol?
The InChIKey is PFEFOYRSMXVNEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O/c1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)18(7,8)9/h10-11,19H,1-9H3.
What are the key properties of 2,4,6-tritert-butylphenol?
2,4,6-tritert-butylphenol has a molecular weight of 262.44 g/mol, XLogP of 5.28, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-tritert-butylphenol is sourced from PubChem (CID 12902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).