3-methoxypent-4-enoic acid

C6H10O3 — CID 12902088

IUPAC3-methoxypent-4-enoic acid
SMILESC=CC(CC(=O)O)OC
InChIInChI=1S/C6H10O3/c1-3-5(9-2)4-6(7)8/h3,5H,1,4H2,2H3,(H,7,8)
InChIKeyNAMQOAHJIAAZCQ-UHFFFAOYSA-N
MW130.14 g/mol
LogP0.66
Rot. Bonds4

About 3-methoxypent-4-enoic acid

3-methoxypent-4-enoic acid (PubChem CID 12902088) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is 3-methoxypent-4-enoic acid.

Molecular Properties

Compound Name3-methoxypent-4-enoic acid
PubChem CID12902088
Molecular FormulaC6H10O3
Molecular Weight130.14 g/mol
Exact Mass130.06
IUPAC Name3-methoxypent-4-enoic acid
SMILESC=CC(CC(=O)O)OC
InChIInChI=1S/C6H10O3/c1-3-5(9-2)4-6(7)8/h3,5H,1,4H2,2H3,(H,7,8)
InChIKeyNAMQOAHJIAAZCQ-UHFFFAOYSA-N
XLogP0.66
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500130.14
LogP ≤ 50.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 3-methoxypent-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methoxypent-4-enoic acid?
The IUPAC name of 3-methoxypent-4-enoic acid (CID 12902088) is 3-methoxypent-4-enoic acid.
What is the SMILES notation for 3-methoxypent-4-enoic acid?
The canonical SMILES for 3-methoxypent-4-enoic acid is C=CC(CC(=O)O)OC.
What is the InChIKey of 3-methoxypent-4-enoic acid?
The InChIKey is NAMQOAHJIAAZCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3/c1-3-5(9-2)4-6(7)8/h3,5H,1,4H2,2H3,(H,7,8).
What are the key properties of 3-methoxypent-4-enoic acid?
3-methoxypent-4-enoic acid has a molecular weight of 130.14 g/mol, XLogP of 0.66, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypent-4-enoic acid is sourced from PubChem (CID 12902088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).