C8H19N3 — CID 12902159
1-N,1-N,1-N',1-N',2-N,2-N-hexamethylethene-1,1,2-triamine (PubChem CID 12902159) has the molecular formula C8H19N3 and a molecular weight of 157.26 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',2-N,2-N-hexamethylethene-1,1,2-triamine.
| Compound Name | 1-N,1-N,1-N',1-N',2-N,2-N-hexamethylethene-1,1,2-triamine |
|---|---|
| PubChem CID | 12902159 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | 1-N,1-N,1-N',1-N',2-N,2-N-hexamethylethene-1,1,2-triamine |
| SMILES | CN(C)C=C(N(C)C)N(C)C |
| InChI | InChI=1S/C8H19N3/c1-9(2)7-8(10(3)4)11(5)6/h7H,1-6H3 |
| InChIKey | PBSUWLOBBSOAJX-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |