C17H21FN4O — CID 129021640
2-[4-(3-fluoropropoxy)phenyl]-N,8-dimethyl-7H-imidazo[1,2-a]pyrimidin-7-amine (PubChem CID 129021640) has the molecular formula C17H21FN4O and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-[4-(3-fluoropropoxy)phenyl]-N,8-dimethyl-7H-imidazo[1,2-a]pyrimidin-7-amine.
| Compound Name | 2-[4-(3-fluoropropoxy)phenyl]-N,8-dimethyl-7H-imidazo[1,2-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 129021640 |
| Molecular Formula | C17H21FN4O |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-[4-(3-fluoropropoxy)phenyl]-N,8-dimethyl-7H-imidazo[1,2-a]pyrimidin-7-amine |
| SMILES | CNC1C=Cn2cc(-c3ccc(OCCCF)cc3)nc2N1C |
| InChI | InChI=1S/C17H21FN4O/c1-19-16-8-10-22-12-15(20-17(22)21(16)2)13-4-6-14(7-5-13)23-11-3-9-18/h4-8,10,12,16,19H,3,9,11H2,1-2H3 |
| InChIKey | QFVDQVIJRJPWKL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|