C16H22BrN5O — CID 129021746
5-bromo-1-methyl-3-[[5-[(2S)-2-methylpiperazin-1-yl]-2-pyridinyl]amino]-2H-pyridin-2-ol (PubChem CID 129021746) has the molecular formula C16H22BrN5O and a molecular weight of 380.29 g/mol. Its IUPAC name is 5-bromo-1-methyl-3-[[5-[(2S)-2-methylpiperazin-1-yl]-2-pyridinyl]amino]-2H-pyridin-2-ol.
| Compound Name | 5-bromo-1-methyl-3-[[5-[(2S)-2-methylpiperazin-1-yl]-2-pyridinyl]amino]-2H-pyridin-2-ol |
|---|---|
| PubChem CID | 129021746 |
| Molecular Formula | C16H22BrN5O |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 5-bromo-1-methyl-3-[[5-[(2S)-2-methylpiperazin-1-yl]-2-pyridinyl]amino]-2H-pyridin-2-ol |
| SMILES | C[C@H]1CNCCN1c1ccc(NC2=CC(Br)=CN(C)C2O)nc1 |
| InChI | InChI=1S/C16H22BrN5O/c1-11-8-18-5-6-22(11)13-3-4-15(19-9-13)20-14-7-12(17)10-21(2)16(14)23/h3-4,7,9-11,16,18,23H,5-6,8H2,1-2H3,(H,19,20)/t11-,16?/m0/s1 |
| InChIKey | FQHOQTFROHVAEU-CHPOKUKFSA-N |
| XLogP | 1.68 |
| TPSA | 63.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |