C24H16F6N8O — CID 129021751
6-[4-amino-5-(4-fluorophenyl)-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazine-2-carbonitrile (PubChem CID 129021751) has the molecular formula C24H16F6N8O and a molecular weight of 546.44 g/mol. Its IUPAC name is 6-[4-amino-5-(4-fluorophenyl)-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazine-2-carbonitrile.
| Compound Name | 6-[4-amino-5-(4-fluorophenyl)-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 129021751 |
| Molecular Formula | C24H16F6N8O |
| Molecular Weight | 546.44 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | 6-[4-amino-5-(4-fluorophenyl)-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazine-2-carbonitrile |
| SMILES | CC1(c2ccc(F)cc2)C(=O)Nc2nc(-c3cn4cc(C#N)nc4c(CCC(F)(F)C(F)(F)F)n3)nc(N)c21 |
| InChI | InChI=1S/C24H16F6N8O/c1-22(11-2-4-12(25)5-3-11)16-17(32)35-18(36-19(16)37-21(22)39)15-10-38-9-13(8-31)33-20(38)14(34-15)6-7-23(26,27)24(28,29)30/h2-5,9-10H,6-7H2,1H3,(H3,32,35,36,37,39) |
| InChIKey | UMZGANRREAPUAL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 134.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|