About methoxymethyl 3-[(2S)-2-aminopropanoyl]oxy-2,2-dimethylpropanoate
methoxymethyl 3-[(2S)-2-aminopropanoyl]oxy-2,2-dimethylpropanoate (PubChem CID 129022149) has the molecular formula C10H19NO5
and a molecular weight of 233.26 g/mol. Its IUPAC name is methoxymethyl 3-[(2S)-2-aminopropanoyl]oxy-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | methoxymethyl 3-[(2S)-2-aminopropanoyl]oxy-2,2-dimethylpropanoate |
| PubChem CID | 129022149 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | methoxymethyl 3-[(2S)-2-aminopropanoyl]oxy-2,2-dimethylpropanoate |
| SMILES | COCOC(=O)C(C)(C)COC(=O)[C@H](C)N |
| InChI | InChI=1S/C10H19NO5/c1-7(11)8(12)15-5-10(2,3)9(13)16-6-14-4/h7H,5-6,11H2,1-4H3/t7-/m0/s1 |
| InChIKey | PKJSXPZKDDEQKP-ZETCQYMHSA-N |
| XLogP | 0.05 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methoxymethyl 3-[(2S)-2-aminopropanoyl]oxy-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethyl 3-[(2S)-2-aminopropanoyl]oxy-2,2-dimethylpropanoate?
The IUPAC name of methoxymethyl 3-[(2S)-2-aminopropanoyl]oxy-2,2-dimethylpropanoate (CID 129022149) is methoxymethyl 3-[(2S)-2-aminopropanoyl]oxy-2,2-dimethylpropanoate.
What is the SMILES notation for methoxymethyl 3-[(2S)-2-aminopropanoyl]oxy-2,2-dimethylpropanoate?
The canonical SMILES for methoxymethyl 3-[(2S)-2-aminopropanoyl]oxy-2,2-dimethylpropanoate is COCOC(=O)C(C)(C)COC(=O)[C@H](C)N.
What is the InChIKey of methoxymethyl 3-[(2S)-2-aminopropanoyl]oxy-2,2-dimethylpropanoate?
The InChIKey is PKJSXPZKDDEQKP-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H19NO5/c1-7(11)8(12)15-5-10(2,3)9(13)16-6-14-4/h7H,5-6,11H2,1-4H3/t7-/m0/s1.
What are the key properties of methoxymethyl 3-[(2S)-2-aminopropanoyl]oxy-2,2-dimethylpropanoate?
methoxymethyl 3-[(2S)-2-aminopropanoyl]oxy-2,2-dimethylpropanoate has a molecular weight of 233.26 g/mol, XLogP of 0.05, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethyl 3-[(2S)-2-aminopropanoyl]oxy-2,2-dimethylpropanoate is sourced from PubChem (CID 129022149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).