About 2-(4,4-difluorocyclohexyl)-N-methyl-N-(3-methylbutyl)acetamide
2-(4,4-difluorocyclohexyl)-N-methyl-N-(3-methylbutyl)acetamide (PubChem CID 129022770) has the molecular formula C14H25F2NO
and a molecular weight of 261.36 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexyl)-N-methyl-N-(3-methylbutyl)acetamide.
Molecular Properties
| Compound Name | 2-(4,4-difluorocyclohexyl)-N-methyl-N-(3-methylbutyl)acetamide |
| PubChem CID | 129022770 |
| Molecular Formula | C14H25F2NO |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | 2-(4,4-difluorocyclohexyl)-N-methyl-N-(3-methylbutyl)acetamide |
| SMILES | CC(C)CCN(C)C(=O)CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H25F2NO/c1-11(2)6-9-17(3)13(18)10-12-4-7-14(15,16)8-5-12/h11-12H,4-10H2,1-3H3 |
| InChIKey | HQCXUENHSIYNMP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4,4-difluorocyclohexyl)-N-methyl-N-(3-methylbutyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluorocyclohexyl)-N-methyl-N-(3-methylbutyl)acetamide?
The IUPAC name of 2-(4,4-difluorocyclohexyl)-N-methyl-N-(3-methylbutyl)acetamide (CID 129022770) is 2-(4,4-difluorocyclohexyl)-N-methyl-N-(3-methylbutyl)acetamide.
What is the SMILES notation for 2-(4,4-difluorocyclohexyl)-N-methyl-N-(3-methylbutyl)acetamide?
The canonical SMILES for 2-(4,4-difluorocyclohexyl)-N-methyl-N-(3-methylbutyl)acetamide is CC(C)CCN(C)C(=O)CC1CCC(F)(F)CC1.
What is the InChIKey of 2-(4,4-difluorocyclohexyl)-N-methyl-N-(3-methylbutyl)acetamide?
The InChIKey is HQCXUENHSIYNMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25F2NO/c1-11(2)6-9-17(3)13(18)10-12-4-7-14(15,16)8-5-12/h11-12H,4-10H2,1-3H3.
What are the key properties of 2-(4,4-difluorocyclohexyl)-N-methyl-N-(3-methylbutyl)acetamide?
2-(4,4-difluorocyclohexyl)-N-methyl-N-(3-methylbutyl)acetamide has a molecular weight of 261.36 g/mol, XLogP of 3.71, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluorocyclohexyl)-N-methyl-N-(3-methylbutyl)acetamide is sourced from PubChem (CID 129022770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).