About 1-benzyl-3-N,5-N-dimethyl-2-oxopyridine-3,5-dicarboxamide
1-benzyl-3-N,5-N-dimethyl-2-oxopyridine-3,5-dicarboxamide (PubChem CID 129022870) has the molecular formula C16H17N3O3
and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-benzyl-3-N,5-N-dimethyl-2-oxopyridine-3,5-dicarboxamide.
Molecular Properties
| Compound Name | 1-benzyl-3-N,5-N-dimethyl-2-oxopyridine-3,5-dicarboxamide |
| PubChem CID | 129022870 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-benzyl-3-N,5-N-dimethyl-2-oxopyridine-3,5-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NC)c(=O)n(Cc2ccccc2)c1 |
| InChI | InChI=1S/C16H17N3O3/c1-17-14(20)12-8-13(15(21)18-2)16(22)19(10-12)9-11-6-4-3-5-7-11/h3-8,10H,9H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | DANLNXYNIAMHCE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-3-N,5-N-dimethyl-2-oxopyridine-3,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-N,5-N-dimethyl-2-oxopyridine-3,5-dicarboxamide?
The IUPAC name of 1-benzyl-3-N,5-N-dimethyl-2-oxopyridine-3,5-dicarboxamide (CID 129022870) is 1-benzyl-3-N,5-N-dimethyl-2-oxopyridine-3,5-dicarboxamide.
What is the SMILES notation for 1-benzyl-3-N,5-N-dimethyl-2-oxopyridine-3,5-dicarboxamide?
The canonical SMILES for 1-benzyl-3-N,5-N-dimethyl-2-oxopyridine-3,5-dicarboxamide is CNC(=O)c1cc(C(=O)NC)c(=O)n(Cc2ccccc2)c1.
What is the InChIKey of 1-benzyl-3-N,5-N-dimethyl-2-oxopyridine-3,5-dicarboxamide?
The InChIKey is DANLNXYNIAMHCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O3/c1-17-14(20)12-8-13(15(21)18-2)16(22)19(10-12)9-11-6-4-3-5-7-11/h3-8,10H,9H2,1-2H3,(H,17,20)(H,18,21).
What are the key properties of 1-benzyl-3-N,5-N-dimethyl-2-oxopyridine-3,5-dicarboxamide?
1-benzyl-3-N,5-N-dimethyl-2-oxopyridine-3,5-dicarboxamide has a molecular weight of 299.33 g/mol, XLogP of 0.62, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-N,5-N-dimethyl-2-oxopyridine-3,5-dicarboxamide is sourced from PubChem (CID 129022870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).