About 3-(oxan-4-yl)oxane
3-(oxan-4-yl)oxane (PubChem CID 129023040) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 3-(oxan-4-yl)oxane.
Molecular Properties
| Compound Name | 3-(oxan-4-yl)oxane |
| PubChem CID | 129023040 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 3-(oxan-4-yl)oxane |
| SMILES | C1COCC(C2CCOCC2)C1 |
| InChI | InChI=1S/C10H18O2/c1-2-10(8-12-5-1)9-3-6-11-7-4-9/h9-10H,1-8H2 |
| InChIKey | JKRQNBNXDXAIKT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(oxan-4-yl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxan-4-yl)oxane?
The IUPAC name of 3-(oxan-4-yl)oxane (CID 129023040) is 3-(oxan-4-yl)oxane.
What is the SMILES notation for 3-(oxan-4-yl)oxane?
The canonical SMILES for 3-(oxan-4-yl)oxane is C1COCC(C2CCOCC2)C1.
What is the InChIKey of 3-(oxan-4-yl)oxane?
The InChIKey is JKRQNBNXDXAIKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-2-10(8-12-5-1)9-3-6-11-7-4-9/h9-10H,1-8H2.
What are the key properties of 3-(oxan-4-yl)oxane?
3-(oxan-4-yl)oxane has a molecular weight of 170.25 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxan-4-yl)oxane is sourced from PubChem (CID 129023040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).