About 1-(cyclopropylmethyl)-3,6-dimethylindazole
1-(cyclopropylmethyl)-3,6-dimethylindazole (PubChem CID 129023140) has the molecular formula C13H16N2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3,6-dimethylindazole.
Molecular Properties
| Compound Name | 1-(cyclopropylmethyl)-3,6-dimethylindazole |
| PubChem CID | 129023140 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 1-(cyclopropylmethyl)-3,6-dimethylindazole |
| SMILES | Cc1ccc2c(C)nn(CC3CC3)c2c1 |
| InChI | InChI=1S/C13H16N2/c1-9-3-6-12-10(2)14-15(13(12)7-9)8-11-4-5-11/h3,6-7,11H,4-5,8H2,1-2H3 |
| InChIKey | GLUSBCJAVIRNQP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(cyclopropylmethyl)-3,6-dimethylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopropylmethyl)-3,6-dimethylindazole?
The IUPAC name of 1-(cyclopropylmethyl)-3,6-dimethylindazole (CID 129023140) is 1-(cyclopropylmethyl)-3,6-dimethylindazole.
What is the SMILES notation for 1-(cyclopropylmethyl)-3,6-dimethylindazole?
The canonical SMILES for 1-(cyclopropylmethyl)-3,6-dimethylindazole is Cc1ccc2c(C)nn(CC3CC3)c2c1.
What is the InChIKey of 1-(cyclopropylmethyl)-3,6-dimethylindazole?
The InChIKey is GLUSBCJAVIRNQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-9-3-6-12-10(2)14-15(13(12)7-9)8-11-4-5-11/h3,6-7,11H,4-5,8H2,1-2H3.
What are the key properties of 1-(cyclopropylmethyl)-3,6-dimethylindazole?
1-(cyclopropylmethyl)-3,6-dimethylindazole has a molecular weight of 200.28 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopropylmethyl)-3,6-dimethylindazole is sourced from PubChem (CID 129023140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).