C22H22F2N4O2S — CID 129023608
5,23-difluoro-16-(methylsulfinylmethyl)-8-oxa-13,19,21,24-tetrazatetracyclo[18.3.1.114,18.02,7]pentacosa-1(24),2(7),3,5,14(25),15,17,20,22-nonaene (PubChem CID 129023608) has the molecular formula C22H22F2N4O2S and a molecular weight of 444.51 g/mol. Its IUPAC name is 5,23-difluoro-16-(methylsulfinylmethyl)-8-oxa-13,19,21,24-tetrazatetracyclo[18.3.1.114,18.02,7]pentacosa-1(24),2(7),3,5,14(25),15,17,20,22-nonaene.
| Compound Name | 5,23-difluoro-16-(methylsulfinylmethyl)-8-oxa-13,19,21,24-tetrazatetracyclo[18.3.1.114,18.02,7]pentacosa-1(24),2(7),3,5,14(25),15,17,20,22-nonaene |
|---|---|
| PubChem CID | 129023608 |
| Molecular Formula | C22H22F2N4O2S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 5,23-difluoro-16-(methylsulfinylmethyl)-8-oxa-13,19,21,24-tetrazatetracyclo[18.3.1.114,18.02,7]pentacosa-1(24),2(7),3,5,14(25),15,17,20,22-nonaene |
| SMILES | CS(=O)Cc1cc2cc(c1)Nc1ncc(F)c(n1)-c1ccc(F)cc1OCCCCN2 |
| InChI | InChI=1S/C22H22F2N4O2S/c1-31(29)13-14-8-16-11-17(9-14)27-22-26-12-19(24)21(28-22)18-5-4-15(23)10-20(18)30-7-3-2-6-25-16/h4-5,8-12,25H,2-3,6-7,13H2,1H3,(H,26,27,28) |
| InChIKey | MQQTUYILAMXWFD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |