About 6-butyl-1-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]pyrazole
6-butyl-1-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]pyrazole (PubChem CID 129024480) has the molecular formula C16H26N2
and a molecular weight of 246.40 g/mol. Its IUPAC name is 6-butyl-1-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]pyrazole.
Molecular Properties
| Compound Name | 6-butyl-1-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]pyrazole |
| PubChem CID | 129024480 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 6-butyl-1-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]pyrazole |
| SMILES | CCCCC1CCc2cnn(C3CCCCC3)c21 |
| InChI | InChI=1S/C16H26N2/c1-2-3-7-13-10-11-14-12-17-18(16(13)14)15-8-5-4-6-9-15/h12-13,15H,2-11H2,1H3 |
| InChIKey | ACIWRPNOZDDJEQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-butyl-1-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-1-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]pyrazole?
The IUPAC name of 6-butyl-1-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]pyrazole (CID 129024480) is 6-butyl-1-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]pyrazole.
What is the SMILES notation for 6-butyl-1-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]pyrazole?
The canonical SMILES for 6-butyl-1-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]pyrazole is CCCCC1CCc2cnn(C3CCCCC3)c21.
What is the InChIKey of 6-butyl-1-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]pyrazole?
The InChIKey is ACIWRPNOZDDJEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2/c1-2-3-7-13-10-11-14-12-17-18(16(13)14)15-8-5-4-6-9-15/h12-13,15H,2-11H2,1H3.
What are the key properties of 6-butyl-1-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]pyrazole?
6-butyl-1-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]pyrazole has a molecular weight of 246.40 g/mol, XLogP of 4.61, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-1-cyclohexyl-5,6-dihydro-4H-cyclopenta[d]pyrazole is sourced from PubChem (CID 129024480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).