C18H21FN4O — CID 129025881
[(3R)-2-(aminomethyl)-3-methylpiperidin-1-yl]-(2-fluoro-6-pyrimidin-2-ylphenyl)methanone (PubChem CID 129025881) has the molecular formula C18H21FN4O and a molecular weight of 328.39 g/mol. Its IUPAC name is [(3R)-2-(aminomethyl)-3-methylpiperidin-1-yl]-(2-fluoro-6-pyrimidin-2-ylphenyl)methanone.
| Compound Name | [(3R)-2-(aminomethyl)-3-methylpiperidin-1-yl]-(2-fluoro-6-pyrimidin-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 129025881 |
| Molecular Formula | C18H21FN4O |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | [(3R)-2-(aminomethyl)-3-methylpiperidin-1-yl]-(2-fluoro-6-pyrimidin-2-ylphenyl)methanone |
| SMILES | C[C@@H]1CCCN(C(=O)c2c(F)cccc2-c2ncccn2)C1CN |
| InChI | InChI=1S/C18H21FN4O/c1-12-5-3-10-23(15(12)11-20)18(24)16-13(6-2-7-14(16)19)17-21-8-4-9-22-17/h2,4,6-9,12,15H,3,5,10-11,20H2,1H3/t12-,15?/m1/s1 |
| InChIKey | JPCAMFKVRWVPIB-KEKZHRQWSA-N |
| XLogP | 2.48 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |