1-hydroxy-2H-pyridine-3-carboxylic acid

C6H7NO3 — CID 12902601

IUPAC1-hydroxy-2H-pyridine-3-carboxylic acid
SMILESO=C(O)C1=CC=CN(O)C1
InChIInChI=1S/C6H7NO3/c8-6(9)5-2-1-3-7(10)4-5/h1-3,10H,4H2,(H,8,9)
InChIKeyUWPJODUHRYXRBU-UHFFFAOYSA-N
MW141.13 g/mol
LogP0.22
Rot. Bonds1

About 1-hydroxy-2H-pyridine-3-carboxylic acid

1-hydroxy-2H-pyridine-3-carboxylic acid (PubChem CID 12902601) has the molecular formula C6H7NO3 and a molecular weight of 141.13 g/mol. Its IUPAC name is 1-hydroxy-2H-pyridine-3-carboxylic acid.

Molecular Properties

Compound Name1-hydroxy-2H-pyridine-3-carboxylic acid
PubChem CID12902601
Molecular FormulaC6H7NO3
Molecular Weight141.13 g/mol
Exact Mass141.04
IUPAC Name1-hydroxy-2H-pyridine-3-carboxylic acid
SMILESO=C(O)C1=CC=CN(O)C1
InChIInChI=1S/C6H7NO3/c8-6(9)5-2-1-3-7(10)4-5/h1-3,10H,4H2,(H,8,9)
InChIKeyUWPJODUHRYXRBU-UHFFFAOYSA-N
XLogP0.22
TPSA60.77 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.13
LogP ≤ 50.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1-hydroxy-2H-pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-hydroxy-2H-pyridine-3-carboxylic acid?
The IUPAC name of 1-hydroxy-2H-pyridine-3-carboxylic acid (CID 12902601) is 1-hydroxy-2H-pyridine-3-carboxylic acid.
What is the SMILES notation for 1-hydroxy-2H-pyridine-3-carboxylic acid?
The canonical SMILES for 1-hydroxy-2H-pyridine-3-carboxylic acid is O=C(O)C1=CC=CN(O)C1.
What is the InChIKey of 1-hydroxy-2H-pyridine-3-carboxylic acid?
The InChIKey is UWPJODUHRYXRBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3/c8-6(9)5-2-1-3-7(10)4-5/h1-3,10H,4H2,(H,8,9).
What are the key properties of 1-hydroxy-2H-pyridine-3-carboxylic acid?
1-hydroxy-2H-pyridine-3-carboxylic acid has a molecular weight of 141.13 g/mol, XLogP of 0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2H-pyridine-3-carboxylic acid is sourced from PubChem (CID 12902601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).