C11H15N3 — CID 129026845
2-(4-methylphenyl)-1,4,5,6-tetrahydropyrimidin-5-amine (PubChem CID 129026845) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1,4,5,6-tetrahydropyrimidin-5-amine.
| Compound Name | 2-(4-methylphenyl)-1,4,5,6-tetrahydropyrimidin-5-amine |
|---|---|
| PubChem CID | 129026845 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2-(4-methylphenyl)-1,4,5,6-tetrahydropyrimidin-5-amine |
| SMILES | Cc1ccc(C2=NCC(N)CN2)cc1 |
| InChI | InChI=1S/C11H15N3/c1-8-2-4-9(5-3-8)11-13-6-10(12)7-14-11/h2-5,10H,6-7,12H2,1H3,(H,13,14) |
| InChIKey | OZUZGKJICLFGMG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |