C6H8O6 — CID 129027461
1,3,5,7-tetraoxecane-8,10-dione (PubChem CID 129027461) has the molecular formula C6H8O6 and a molecular weight of 176.12 g/mol. Its IUPAC name is 1,3,5,7-tetraoxecane-8,10-dione.
| Compound Name | 1,3,5,7-tetraoxecane-8,10-dione |
|---|---|
| PubChem CID | 129027461 |
| Molecular Formula | C6H8O6 |
| Molecular Weight | 176.12 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 1,3,5,7-tetraoxecane-8,10-dione |
| SMILES | O=C1CC(=O)OCOCOCO1 |
| InChI | InChI=1S/C6H8O6/c7-5-1-6(8)12-4-10-2-9-3-11-5/h1-4H2 |
| InChIKey | MJFCQKLFRWEIDX-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.12 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|