About (5R)-2,5-dimethyl-1,3-dioxolan-4-one
(5R)-2,5-dimethyl-1,3-dioxolan-4-one (PubChem CID 129027651) has the molecular formula C5H8O3
and a molecular weight of 116.12 g/mol. Its IUPAC name is (5R)-2,5-dimethyl-1,3-dioxolan-4-one.
Molecular Properties
| Compound Name | (5R)-2,5-dimethyl-1,3-dioxolan-4-one |
| PubChem CID | 129027651 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | (5R)-2,5-dimethyl-1,3-dioxolan-4-one |
| SMILES | CC1OC(=O)[C@@H](C)O1 |
| InChI | InChI=1S/C5H8O3/c1-3-5(6)8-4(2)7-3/h3-4H,1-2H3/t3-,4?/m1/s1 |
| InChIKey | HZEDJCAGLIJEAI-SYPWQXSBSA-N |
| XLogP | 0.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5R)-2,5-dimethyl-1,3-dioxolan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-2,5-dimethyl-1,3-dioxolan-4-one?
The IUPAC name of (5R)-2,5-dimethyl-1,3-dioxolan-4-one (CID 129027651) is (5R)-2,5-dimethyl-1,3-dioxolan-4-one.
What is the SMILES notation for (5R)-2,5-dimethyl-1,3-dioxolan-4-one?
The canonical SMILES for (5R)-2,5-dimethyl-1,3-dioxolan-4-one is CC1OC(=O)[C@@H](C)O1.
What is the InChIKey of (5R)-2,5-dimethyl-1,3-dioxolan-4-one?
The InChIKey is HZEDJCAGLIJEAI-SYPWQXSBSA-N. The full InChI is InChI=1S/C5H8O3/c1-3-5(6)8-4(2)7-3/h3-4H,1-2H3/t3-,4?/m1/s1.
What are the key properties of (5R)-2,5-dimethyl-1,3-dioxolan-4-one?
(5R)-2,5-dimethyl-1,3-dioxolan-4-one has a molecular weight of 116.12 g/mol, XLogP of 0.29, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-2,5-dimethyl-1,3-dioxolan-4-one is sourced from PubChem (CID 129027651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).