C27H21NO3S — CID 129027666
2-(1-benzothiophen-3-yl)-8-methyl-5-[(1S)-1-phenylethoxy]quinoline-4-carboxylic acid (PubChem CID 129027666) has the molecular formula C27H21NO3S and a molecular weight of 439.54 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-8-methyl-5-[(1S)-1-phenylethoxy]quinoline-4-carboxylic acid.
| Compound Name | 2-(1-benzothiophen-3-yl)-8-methyl-5-[(1S)-1-phenylethoxy]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 129027666 |
| Molecular Formula | C27H21NO3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-8-methyl-5-[(1S)-1-phenylethoxy]quinoline-4-carboxylic acid |
| SMILES | Cc1ccc(O[C@@H](C)c2ccccc2)c2c(C(=O)O)cc(-c3csc4ccccc34)nc12 |
| InChI | InChI=1S/C27H21NO3S/c1-16-12-13-23(31-17(2)18-8-4-3-5-9-18)25-20(27(29)30)14-22(28-26(16)25)21-15-32-24-11-7-6-10-19(21)24/h3-15,17H,1-2H3,(H,29,30)/t17-/m0/s1 |
| InChIKey | BBYOWLNBIVXMQP-KRWDZBQOSA-N |
| XLogP | 7.26 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |