About (3,4-diaminophenyl)methanol
(3,4-diaminophenyl)methanol (PubChem CID 12902832) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is (3,4-diaminophenyl)methanol.
Molecular Properties
| Compound Name | (3,4-diaminophenyl)methanol |
| PubChem CID | 12902832 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (3,4-diaminophenyl)methanol |
| SMILES | Nc1ccc(CO)cc1N |
| InChI | InChI=1S/C7H10N2O/c8-6-2-1-5(4-10)3-7(6)9/h1-3,10H,4,8-9H2 |
| InChIKey | HMVJXTUUQJUYJI-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3,4-diaminophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-diaminophenyl)methanol?
The IUPAC name of (3,4-diaminophenyl)methanol (CID 12902832) is (3,4-diaminophenyl)methanol.
What is the SMILES notation for (3,4-diaminophenyl)methanol?
The canonical SMILES for (3,4-diaminophenyl)methanol is Nc1ccc(CO)cc1N.
What is the InChIKey of (3,4-diaminophenyl)methanol?
The InChIKey is HMVJXTUUQJUYJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c8-6-2-1-5(4-10)3-7(6)9/h1-3,10H,4,8-9H2.
What are the key properties of (3,4-diaminophenyl)methanol?
(3,4-diaminophenyl)methanol has a molecular weight of 138.17 g/mol, XLogP of 0.34, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-diaminophenyl)methanol is sourced from PubChem (CID 12902832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).