C18H29NO6S3 — CID 129028518
3-O-[1-[5-(dithiolan-3-yl)pentanoyloxy]ethyl] 4-O-methyl 5,5-dimethyl-1,3-thiazolidine-3,4-dicarboxylate (PubChem CID 129028518) has the molecular formula C18H29NO6S3 and a molecular weight of 451.63 g/mol. Its IUPAC name is 3-O-[1-[5-(dithiolan-3-yl)pentanoyloxy]ethyl] 4-O-methyl 5,5-dimethyl-1,3-thiazolidine-3,4-dicarboxylate.
| Compound Name | 3-O-[1-[5-(dithiolan-3-yl)pentanoyloxy]ethyl] 4-O-methyl 5,5-dimethyl-1,3-thiazolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 129028518 |
| Molecular Formula | C18H29NO6S3 |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 3-O-[1-[5-(dithiolan-3-yl)pentanoyloxy]ethyl] 4-O-methyl 5,5-dimethyl-1,3-thiazolidine-3,4-dicarboxylate |
| SMILES | COC(=O)C1N(C(=O)OC(C)OC(=O)CCCCC2CCSS2)CSC1(C)C |
| InChI | InChI=1S/C18H29NO6S3/c1-12(24-14(20)8-6-5-7-13-9-10-27-28-13)25-17(22)19-11-26-18(2,3)15(19)16(21)23-4/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | GZIBYCSBIXHQOK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|