C18H27N5O5P2 — CID 129028828
5-[[1-[4-[[amino-(methylphosphanylamino)methylidene]amino]phenoxy]-2-methyl-1-oxopropan-2-yl]amino]-2-(methylidenephosphanylamino)-5-oxopentanoic acid (PubChem CID 129028828) has the molecular formula C18H27N5O5P2 and a molecular weight of 455.39 g/mol. Its IUPAC name is 5-[[1-[4-[[amino-(methylphosphanylamino)methylidene]amino]phenoxy]-2-methyl-1-oxopropan-2-yl]amino]-2-(methylidenephosphanylamino)-5-oxopentanoic acid.
| Compound Name | 5-[[1-[4-[[amino-(methylphosphanylamino)methylidene]amino]phenoxy]-2-methyl-1-oxopropan-2-yl]amino]-2-(methylidenephosphanylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 129028828 |
| Molecular Formula | C18H27N5O5P2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 5-[[1-[4-[[amino-(methylphosphanylamino)methylidene]amino]phenoxy]-2-methyl-1-oxopropan-2-yl]amino]-2-(methylidenephosphanylamino)-5-oxopentanoic acid |
| SMILES | C=PNC(CCC(=O)NC(C)(C)C(=O)Oc1ccc(/N=C(\N)NPC)cc1)C(=O)O |
| InChI | InChI=1S/C18H27N5O5P2/c1-18(2,21-14(24)10-9-13(15(25)26)22-29-3)16(27)28-12-7-5-11(6-8-12)20-17(19)23-30-4/h5-8,13,22,30H,3,9-10H2,1-2,4H3,(H,21,24)(H,25,26)(H3,19,20,23) |
| InChIKey | DSQXSSOWKHFTPK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|