C25H35ClN4 — CID 129028919
2-N-[4-[1-(9-chloro-5,6,7,8-tetrahydroacridin-3-yl)ethenylamino]butyl]hex-1-ene-2,5-diamine (PubChem CID 129028919) has the molecular formula C25H35ClN4 and a molecular weight of 427.04 g/mol. Its IUPAC name is 2-N-[4-[1-(9-chloro-5,6,7,8-tetrahydroacridin-3-yl)ethenylamino]butyl]hex-1-ene-2,5-diamine.
| Compound Name | 2-N-[4-[1-(9-chloro-5,6,7,8-tetrahydroacridin-3-yl)ethenylamino]butyl]hex-1-ene-2,5-diamine |
|---|---|
| PubChem CID | 129028919 |
| Molecular Formula | C25H35ClN4 |
| Molecular Weight | 427.04 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 2-N-[4-[1-(9-chloro-5,6,7,8-tetrahydroacridin-3-yl)ethenylamino]butyl]hex-1-ene-2,5-diamine |
| SMILES | C=C(CCC(C)N)NCCCCNC(=C)c1ccc2c(Cl)c3c(nc2c1)CCCC3 |
| InChI | InChI=1S/C25H35ClN4/c1-17(27)10-11-18(2)28-14-6-7-15-29-19(3)20-12-13-22-24(16-20)30-23-9-5-4-8-21(23)25(22)26/h12-13,16-17,28-29H,2-11,14-15,27H2,1H3 |
| InChIKey | LLVJFQCTOPFAGC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.04 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|