C26H32Cl2N4O4 — CID 129029234
[[4-(2,6-diacetamidohexanoylamino)phenyl]-phenylmethyl] 2,2-dichloropropanimidate (PubChem CID 129029234) has the molecular formula C26H32Cl2N4O4 and a molecular weight of 535.47 g/mol. Its IUPAC name is [[4-(2,6-diacetamidohexanoylamino)phenyl]-phenylmethyl] 2,2-dichloropropanimidate.
| Compound Name | [[4-(2,6-diacetamidohexanoylamino)phenyl]-phenylmethyl] 2,2-dichloropropanimidate |
|---|---|
| PubChem CID | 129029234 |
| Molecular Formula | C26H32Cl2N4O4 |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | [[4-(2,6-diacetamidohexanoylamino)phenyl]-phenylmethyl] 2,2-dichloropropanimidate |
| SMILES | [H]/N=C(/OC(c1ccccc1)c1ccc(NC(=O)C(CCCCNC(C)=O)NC(C)=O)cc1)C(C)(Cl)Cl |
| InChI | InChI=1S/C26H32Cl2N4O4/c1-17(33)30-16-8-7-11-22(31-18(2)34)24(35)32-21-14-12-20(13-15-21)23(19-9-5-4-6-10-19)36-25(29)26(3,27)28/h4-6,9-10,12-15,22-23,29H,7-8,11,16H2,1-3H3,(H,30,33)(H,31,34)(H,32,35)/b29-25+ |
| InChIKey | ZAUFFXWUHRCQRA-XLVZBRSZSA-N |
| XLogP | 4.71 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|