C23H25FN4O3 — CID 129029917
methyl 8-[1-(3-fluoro-N-methylanilino)ethyl]-2-morpholin-4-ylquinoxaline-6-carboxylate (PubChem CID 129029917) has the molecular formula C23H25FN4O3 and a molecular weight of 424.48 g/mol. Its IUPAC name is methyl 8-[1-(3-fluoro-N-methylanilino)ethyl]-2-morpholin-4-ylquinoxaline-6-carboxylate.
| Compound Name | methyl 8-[1-(3-fluoro-N-methylanilino)ethyl]-2-morpholin-4-ylquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 129029917 |
| Molecular Formula | C23H25FN4O3 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | methyl 8-[1-(3-fluoro-N-methylanilino)ethyl]-2-morpholin-4-ylquinoxaline-6-carboxylate |
| SMILES | COC(=O)c1cc(C(C)N(C)c2cccc(F)c2)c2nc(N3CCOCC3)cnc2c1 |
| InChI | InChI=1S/C23H25FN4O3/c1-15(27(2)18-6-4-5-17(24)13-18)19-11-16(23(29)30-3)12-20-22(19)26-21(14-25-20)28-7-9-31-10-8-28/h4-6,11-15H,7-10H2,1-3H3 |
| InChIKey | GJXBJNFNVVCIOU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |