C28H32F2N6O2 — CID 129030123
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[8-[(1R)-1-(3,4-difluoroanilino)ethyl]-2-morpholin-4-ylquinoxalin-6-yl]methanone (PubChem CID 129030123) has the molecular formula C28H32F2N6O2 and a molecular weight of 522.60 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[8-[(1R)-1-(3,4-difluoroanilino)ethyl]-2-morpholin-4-ylquinoxalin-6-yl]methanone.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[8-[(1R)-1-(3,4-difluoroanilino)ethyl]-2-morpholin-4-ylquinoxalin-6-yl]methanone |
|---|---|
| PubChem CID | 129030123 |
| Molecular Formula | C28H32F2N6O2 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[8-[(1R)-1-(3,4-difluoroanilino)ethyl]-2-morpholin-4-ylquinoxalin-6-yl]methanone |
| SMILES | C[C@@H](Nc1ccc(F)c(F)c1)c1cc(C(=O)N2CCN3CCCC3C2)cc2ncc(N3CCOCC3)nc12 |
| InChI | InChI=1S/C28H32F2N6O2/c1-18(32-20-4-5-23(29)24(30)15-20)22-13-19(28(37)36-8-7-34-6-2-3-21(34)17-36)14-25-27(22)33-26(16-31-25)35-9-11-38-12-10-35/h4-5,13-16,18,21,32H,2-3,6-12,17H2,1H3/t18-,21?/m1/s1 |
| InChIKey | GJUDQTTXFOORFP-ITUIMRKVSA-N |
| XLogP | 3.84 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |