About [8-[1-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-morpholin-4-ylquinoxalin-6-yl]methanol
[8-[1-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-morpholin-4-ylquinoxalin-6-yl]methanol (PubChem CID 129030431) has the molecular formula C23H24F2N4O2
and a molecular weight of 426.47 g/mol. Its IUPAC name is [8-[1-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-morpholin-4-ylquinoxalin-6-yl]methanol.
Molecular Properties
| Compound Name | [8-[1-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-morpholin-4-ylquinoxalin-6-yl]methanol |
| PubChem CID | 129030431 |
| Molecular Formula | C23H24F2N4O2 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [8-[1-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-morpholin-4-ylquinoxalin-6-yl]methanol |
| SMILES | OCc1cc(C2CCCN2c2cc(F)cc(F)c2)c2nc(N3CCOCC3)cnc2c1 |
| InChI | InChI=1S/C23H24F2N4O2/c24-16-10-17(25)12-18(11-16)29-3-1-2-21(29)19-8-15(14-30)9-20-23(19)27-22(13-26-20)28-4-6-31-7-5-28/h8-13,21,30H,1-7,14H2 |
| InChIKey | KFWZYLWTCNKMPV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [8-[1-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-morpholin-4-ylquinoxalin-6-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-[1-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-morpholin-4-ylquinoxalin-6-yl]methanol?
The IUPAC name of [8-[1-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-morpholin-4-ylquinoxalin-6-yl]methanol (CID 129030431) is [8-[1-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-morpholin-4-ylquinoxalin-6-yl]methanol.
What is the SMILES notation for [8-[1-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-morpholin-4-ylquinoxalin-6-yl]methanol?
The canonical SMILES for [8-[1-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-morpholin-4-ylquinoxalin-6-yl]methanol is OCc1cc(C2CCCN2c2cc(F)cc(F)c2)c2nc(N3CCOCC3)cnc2c1.
What is the InChIKey of [8-[1-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-morpholin-4-ylquinoxalin-6-yl]methanol?
The InChIKey is KFWZYLWTCNKMPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24F2N4O2/c24-16-10-17(25)12-18(11-16)29-3-1-2-21(29)19-8-15(14-30)9-20-23(19)27-22(13-26-20)28-4-6-31-7-5-28/h8-13,21,30H,1-7,14H2.
What are the key properties of [8-[1-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-morpholin-4-ylquinoxalin-6-yl]methanol?
[8-[1-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-morpholin-4-ylquinoxalin-6-yl]methanol has a molecular weight of 426.47 g/mol, XLogP of 3.58, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [8-[1-(3,5-difluorophenyl)pyrrolidin-2-yl]-2-morpholin-4-ylquinoxalin-6-yl]methanol is sourced from PubChem (CID 129030431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).