C25H26F3N5O3 — CID 129030657
4-[1-[[1-[[4-(dimethylamino)phenyl]methyl]-6-(trifluoromethyl)-2,3-dihydroimidazo[2,1-e]pyrazole-7-carbonyl]amino]ethyl]benzoic acid (PubChem CID 129030657) has the molecular formula C25H26F3N5O3 and a molecular weight of 501.51 g/mol. Its IUPAC name is 4-[1-[[1-[[4-(dimethylamino)phenyl]methyl]-6-(trifluoromethyl)-2,3-dihydroimidazo[2,1-e]pyrazole-7-carbonyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[1-[[1-[[4-(dimethylamino)phenyl]methyl]-6-(trifluoromethyl)-2,3-dihydroimidazo[2,1-e]pyrazole-7-carbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 129030657 |
| Molecular Formula | C25H26F3N5O3 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 4-[1-[[1-[[4-(dimethylamino)phenyl]methyl]-6-(trifluoromethyl)-2,3-dihydroimidazo[2,1-e]pyrazole-7-carbonyl]amino]ethyl]benzoic acid |
| SMILES | CC(NC(=O)c1c(C(F)(F)F)nn2c1N(Cc1ccc(N(C)C)cc1)CC2)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H26F3N5O3/c1-15(17-6-8-18(9-7-17)24(35)36)29-22(34)20-21(25(26,27)28)30-33-13-12-32(23(20)33)14-16-4-10-19(11-5-16)31(2)3/h4-11,15H,12-14H2,1-3H3,(H,29,34)(H,35,36) |
| InChIKey | HLHDTLYPYQLBIJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|