C20H25N5O2 — CID 129031049
3-[4-(5-hydroxypyrimidin-2-yl)piperazin-1-yl]-1-[(4-methylphenyl)methyl]pyrrolidin-2-one (PubChem CID 129031049) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-[4-(5-hydroxypyrimidin-2-yl)piperazin-1-yl]-1-[(4-methylphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 3-[4-(5-hydroxypyrimidin-2-yl)piperazin-1-yl]-1-[(4-methylphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 129031049 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 3-[4-(5-hydroxypyrimidin-2-yl)piperazin-1-yl]-1-[(4-methylphenyl)methyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(CN2CCC(N3CCN(c4ncc(O)cn4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C20H25N5O2/c1-15-2-4-16(5-3-15)14-25-7-6-18(19(25)27)23-8-10-24(11-9-23)20-21-12-17(26)13-22-20/h2-5,12-13,18,26H,6-11,14H2,1H3 |
| InChIKey | MBCDLIDXJUYWNM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |