C10H16N2O3 — CID 129031348
tert-butyl 3-cyano-2-hydroxypyrrolidine-1-carboxylate (PubChem CID 129031348) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is tert-butyl 3-cyano-2-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-cyano-2-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 129031348 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | tert-butyl 3-cyano-2-hydroxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C#N)C1O |
| InChI | InChI=1S/C10H16N2O3/c1-10(2,3)15-9(14)12-5-4-7(6-11)8(12)13/h7-8,13H,4-5H2,1-3H3 |
| InChIKey | IDWRQEMXMLWPPA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |