C15H28O — CID 129031543
3-(3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroinden-5-yl)-2-methylpropan-1-ol (PubChem CID 129031543) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is 3-(3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroinden-5-yl)-2-methylpropan-1-ol.
| Compound Name | 3-(3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroinden-5-yl)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 129031543 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 3-(3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroinden-5-yl)-2-methylpropan-1-ol |
| SMILES | CC(CO)CC1CCC2CCC(C)(C)C2C1 |
| InChI | InChI=1S/C15H28O/c1-11(10-16)8-12-4-5-13-6-7-15(2,3)14(13)9-12/h11-14,16H,4-10H2,1-3H3 |
| InChIKey | NQJRTPKEUSSXRO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |