C26H22F2N4O3 — CID 129031816
3-[4-[(2,5-difluorophenyl)methoxy]phenyl]-1-(1-prop-2-enoylpyrrolidin-3-yl)imidazo[4,5-c]pyridin-2-one (PubChem CID 129031816) has the molecular formula C26H22F2N4O3 and a molecular weight of 476.48 g/mol. Its IUPAC name is 3-[4-[(2,5-difluorophenyl)methoxy]phenyl]-1-(1-prop-2-enoylpyrrolidin-3-yl)imidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-[4-[(2,5-difluorophenyl)methoxy]phenyl]-1-(1-prop-2-enoylpyrrolidin-3-yl)imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 129031816 |
| Molecular Formula | C26H22F2N4O3 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 3-[4-[(2,5-difluorophenyl)methoxy]phenyl]-1-(1-prop-2-enoylpyrrolidin-3-yl)imidazo[4,5-c]pyridin-2-one |
| SMILES | C=CC(=O)N1CCC(n2c(=O)n(-c3ccc(OCc4cc(F)ccc4F)cc3)c3cnccc32)C1 |
| InChI | InChI=1S/C26H22F2N4O3/c1-2-25(33)30-12-10-20(15-30)32-23-9-11-29-14-24(23)31(26(32)34)19-4-6-21(7-5-19)35-16-17-13-18(27)3-8-22(17)28/h2-9,11,13-14,20H,1,10,12,15-16H2 |
| InChIKey | JDOUDKBBMSNXMO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|