About [3-(2-oxo-3H-imidazo[4,5-c]pyridin-1-yl)phenyl]carbamic acid
[3-(2-oxo-3H-imidazo[4,5-c]pyridin-1-yl)phenyl]carbamic acid (PubChem CID 129031933) has the molecular formula C13H10N4O3
and a molecular weight of 270.25 g/mol. Its IUPAC name is [3-(2-oxo-3H-imidazo[4,5-c]pyridin-1-yl)phenyl]carbamic acid.
Molecular Properties
| Compound Name | [3-(2-oxo-3H-imidazo[4,5-c]pyridin-1-yl)phenyl]carbamic acid |
| PubChem CID | 129031933 |
| Molecular Formula | C13H10N4O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | [3-(2-oxo-3H-imidazo[4,5-c]pyridin-1-yl)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1cccc(-n2c(=O)[nH]c3cnccc32)c1 |
| InChI | InChI=1S/C13H10N4O3/c18-12-16-10-7-14-5-4-11(10)17(12)9-3-1-2-8(6-9)15-13(19)20/h1-7,15H,(H,16,18)(H,19,20) |
| InChIKey | OCSUDRPNIGZNPG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(2-oxo-3H-imidazo[4,5-c]pyridin-1-yl)phenyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-oxo-3H-imidazo[4,5-c]pyridin-1-yl)phenyl]carbamic acid?
The IUPAC name of [3-(2-oxo-3H-imidazo[4,5-c]pyridin-1-yl)phenyl]carbamic acid (CID 129031933) is [3-(2-oxo-3H-imidazo[4,5-c]pyridin-1-yl)phenyl]carbamic acid.
What is the SMILES notation for [3-(2-oxo-3H-imidazo[4,5-c]pyridin-1-yl)phenyl]carbamic acid?
The canonical SMILES for [3-(2-oxo-3H-imidazo[4,5-c]pyridin-1-yl)phenyl]carbamic acid is O=C(O)Nc1cccc(-n2c(=O)[nH]c3cnccc32)c1.
What is the InChIKey of [3-(2-oxo-3H-imidazo[4,5-c]pyridin-1-yl)phenyl]carbamic acid?
The InChIKey is OCSUDRPNIGZNPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O3/c18-12-16-10-7-14-5-4-11(10)17(12)9-3-1-2-8(6-9)15-13(19)20/h1-7,15H,(H,16,18)(H,19,20).
What are the key properties of [3-(2-oxo-3H-imidazo[4,5-c]pyridin-1-yl)phenyl]carbamic acid?
[3-(2-oxo-3H-imidazo[4,5-c]pyridin-1-yl)phenyl]carbamic acid has a molecular weight of 270.25 g/mol, XLogP of 1.80, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-oxo-3H-imidazo[4,5-c]pyridin-1-yl)phenyl]carbamic acid is sourced from PubChem (CID 129031933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).