C26H21ClF2N4O3 — CID 129032159
3-[3-chloro-4-[(3,5-difluorophenyl)methoxy]phenyl]-1-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]imidazo[4,5-c]pyridin-2-one (PubChem CID 129032159) has the molecular formula C26H21ClF2N4O3 and a molecular weight of 510.93 g/mol. Its IUPAC name is 3-[3-chloro-4-[(3,5-difluorophenyl)methoxy]phenyl]-1-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]imidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-[3-chloro-4-[(3,5-difluorophenyl)methoxy]phenyl]-1-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 129032159 |
| Molecular Formula | C26H21ClF2N4O3 |
| Molecular Weight | 510.93 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 3-[3-chloro-4-[(3,5-difluorophenyl)methoxy]phenyl]-1-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]imidazo[4,5-c]pyridin-2-one |
| SMILES | C=CC(=O)N1CC[C@@H](n2c(=O)n(-c3ccc(OCc4cc(F)cc(F)c4)c(Cl)c3)c3cnccc32)C1 |
| InChI | InChI=1S/C26H21ClF2N4O3/c1-2-25(34)31-8-6-20(14-31)33-22-5-7-30-13-23(22)32(26(33)35)19-3-4-24(21(27)12-19)36-15-16-9-17(28)11-18(29)10-16/h2-5,7,9-13,20H,1,6,8,14-15H2/t20-/m1/s1 |
| InChIKey | NEUWFDFMDXRHSY-HXUWFJFHSA-N |
| XLogP | 4.66 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.93 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|