C21H20F3N3O3 — CID 129032652
N-[2-[4-(furan-3-ylmethyl)piperazin-1-yl]-5-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 129032652) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is N-[2-[4-(furan-3-ylmethyl)piperazin-1-yl]-5-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[2-[4-(furan-3-ylmethyl)piperazin-1-yl]-5-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 129032652 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-[2-[4-(furan-3-ylmethyl)piperazin-1-yl]-5-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1N1CCN(Cc2ccoc2)CC1)c1ccco1 |
| InChI | InChI=1S/C21H20F3N3O3/c22-21(23,24)16-3-4-18(17(12-16)25-20(28)19-2-1-10-30-19)27-8-6-26(7-9-27)13-15-5-11-29-14-15/h1-5,10-12,14H,6-9,13H2,(H,25,28) |
| InChIKey | XIZOXIDAGVIENF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 61.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |