C17H12F5N5O — CID 129032722
5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-[1-(2,4,5-trifluorophenyl)cyclobutyl]pyrimidin-2-amine (PubChem CID 129032722) has the molecular formula C17H12F5N5O and a molecular weight of 397.31 g/mol. Its IUPAC name is 5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-[1-(2,4,5-trifluorophenyl)cyclobutyl]pyrimidin-2-amine.
| Compound Name | 5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-[1-(2,4,5-trifluorophenyl)cyclobutyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 129032722 |
| Molecular Formula | C17H12F5N5O |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-[1-(2,4,5-trifluorophenyl)cyclobutyl]pyrimidin-2-amine |
| SMILES | Fc1cc(F)c(C2(Nc3ncc(-c4nnc(C(F)F)o4)cn3)CCC2)cc1F |
| InChI | InChI=1S/C17H12F5N5O/c18-10-5-12(20)11(19)4-9(10)17(2-1-3-17)25-16-23-6-8(7-24-16)14-26-27-15(28-14)13(21)22/h4-7,13H,1-3H2,(H,23,24,25) |
| InChIKey | IONASXYPOBMBBE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|