About N-(C,N-dimethylcarbonimidoyl)-N-methylpropanamide
N-(C,N-dimethylcarbonimidoyl)-N-methylpropanamide (PubChem CID 129033099) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is N-(C,N-dimethylcarbonimidoyl)-N-methylpropanamide.
Molecular Properties
| Compound Name | N-(C,N-dimethylcarbonimidoyl)-N-methylpropanamide |
|---|
| PubChem CID | 129033099 |
|---|
| Molecular Formula | C7H14N2O |
|---|
| Molecular Weight | 142.20 g/mol |
|---|
| Exact Mass | 142.11 |
|---|
| IUPAC Name | N-(C,N-dimethylcarbonimidoyl)-N-methylpropanamide |
|---|
| SMILES | CCC(=O)N(C)/C(C)=N/C |
|---|
| InChI | InChI=1S/C7H14N2O/c1-5-7(10)9(4)6(2)8-3/h5H2,1-4H3/b8-6+ |
|---|
| InChIKey | PMMKEIMPDLAVHX-SOFGYWHQSA-N |
|---|
| XLogP | 0.90 |
|---|
| TPSA | 32.67 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | 1 |
|---|
| Heavy Atoms | 10 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(C,N-dimethylcarbonimidoyl)-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(C,N-dimethylcarbonimidoyl)-N-methylpropanamide?
The IUPAC name of N-(C,N-dimethylcarbonimidoyl)-N-methylpropanamide (CID 129033099) is N-(C,N-dimethylcarbonimidoyl)-N-methylpropanamide.
What is the SMILES notation for N-(C,N-dimethylcarbonimidoyl)-N-methylpropanamide?
The canonical SMILES for N-(C,N-dimethylcarbonimidoyl)-N-methylpropanamide is CCC(=O)N(C)/C(C)=N/C.
What is the InChIKey of N-(C,N-dimethylcarbonimidoyl)-N-methylpropanamide?
The InChIKey is PMMKEIMPDLAVHX-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H14N2O/c1-5-7(10)9(4)6(2)8-3/h5H2,1-4H3/b8-6+.
What are the key properties of N-(C,N-dimethylcarbonimidoyl)-N-methylpropanamide?
N-(C,N-dimethylcarbonimidoyl)-N-methylpropanamide has a molecular weight of 142.20 g/mol, XLogP of 0.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(C,N-dimethylcarbonimidoyl)-N-methylpropanamide is sourced from PubChem (CID 129033099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).