C28H24N4 — CID 129033195
2-methyl-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-naphthalen-2-ylpyrimidin-4-amine (PubChem CID 129033195) has the molecular formula C28H24N4 and a molecular weight of 416.53 g/mol. Its IUPAC name is 2-methyl-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-naphthalen-2-ylpyrimidin-4-amine.
| Compound Name | 2-methyl-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-naphthalen-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 129033195 |
| Molecular Formula | C28H24N4 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 2-methyl-N-[[4-(2-methyl-4-pyridinyl)phenyl]methyl]-6-naphthalen-2-ylpyrimidin-4-amine |
| SMILES | Cc1cc(-c2ccc(CNc3cc(-c4ccc5ccccc5c4)nc(C)n3)cc2)ccn1 |
| InChI | InChI=1S/C28H24N4/c1-19-15-25(13-14-29-19)23-9-7-21(8-10-23)18-30-28-17-27(31-20(2)32-28)26-12-11-22-5-3-4-6-24(22)16-26/h3-17H,18H2,1-2H3,(H,30,31,32) |
| InChIKey | NIIDVAPEIQNACW-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |