C24H17N5O4 — CID 1290337
N-[5-(1,3-dioxoisoindol-2-yl)-1-phenyl-1,2,4-triazol-3-yl]-4-methoxybenzamide (PubChem CID 1290337) has the molecular formula C24H17N5O4 and a molecular weight of 439.43 g/mol. Its IUPAC name is N-[5-(1,3-dioxoisoindol-2-yl)-1-phenyl-1,2,4-triazol-3-yl]-4-methoxybenzamide.
| Compound Name | N-[5-(1,3-dioxoisoindol-2-yl)-1-phenyl-1,2,4-triazol-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 1290337 |
| Molecular Formula | C24H17N5O4 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-[5-(1,3-dioxoisoindol-2-yl)-1-phenyl-1,2,4-triazol-3-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2nc(N3C(=O)c4ccccc4C3=O)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H17N5O4/c1-33-17-13-11-15(12-14-17)20(30)25-23-26-24(29(27-23)16-7-3-2-4-8-16)28-21(31)18-9-5-6-10-19(18)22(28)32/h2-14H,1H3,(H,25,27,30) |
| InChIKey | IIWVUMZJBLGECT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|