C28H38N4O4 — CID 129033820
ethyl 6-[[(1R,3R)-3-hydroxycyclohexyl]amino]-5-(2-methylpropanimidoyl)-4-(4-morpholin-4-ylphenyl)pyridine-2-carboxylate (PubChem CID 129033820) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is ethyl 6-[[(1R,3R)-3-hydroxycyclohexyl]amino]-5-(2-methylpropanimidoyl)-4-(4-morpholin-4-ylphenyl)pyridine-2-carboxylate.
| Compound Name | ethyl 6-[[(1R,3R)-3-hydroxycyclohexyl]amino]-5-(2-methylpropanimidoyl)-4-(4-morpholin-4-ylphenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 129033820 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | ethyl 6-[[(1R,3R)-3-hydroxycyclohexyl]amino]-5-(2-methylpropanimidoyl)-4-(4-morpholin-4-ylphenyl)pyridine-2-carboxylate |
| SMILES | [H]/N=C(/c1c(-c2ccc(N3CCOCC3)cc2)cc(C(=O)OCC)nc1N[C@@H]1CCC[C@@H](O)C1)C(C)C |
| InChI | InChI=1S/C28H38N4O4/c1-4-36-28(34)24-17-23(19-8-10-21(11-9-19)32-12-14-35-15-13-32)25(26(29)18(2)3)27(31-24)30-20-6-5-7-22(33)16-20/h8-11,17-18,20,22,29,33H,4-7,12-16H2,1-3H3,(H,30,31)/b29-26+/t20-,22-/m1/s1 |
| InChIKey | QGSVHDUQENYELB-NNBZJSHOSA-N |
| XLogP | 4.50 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|