C19H39NO — CID 129033928
2-butyl-N-(2,2-dimethylpropyl)-2-methylnonanamide (PubChem CID 129033928) has the molecular formula C19H39NO and a molecular weight of 297.53 g/mol. Its IUPAC name is 2-butyl-N-(2,2-dimethylpropyl)-2-methylnonanamide.
| Compound Name | 2-butyl-N-(2,2-dimethylpropyl)-2-methylnonanamide |
|---|---|
| PubChem CID | 129033928 |
| Molecular Formula | C19H39NO |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.30 |
| IUPAC Name | 2-butyl-N-(2,2-dimethylpropyl)-2-methylnonanamide |
| SMILES | CCCCCCCC(C)(CCCC)C(=O)NCC(C)(C)C |
| InChI | InChI=1S/C19H39NO/c1-7-9-11-12-13-15-19(6,14-10-8-2)17(21)20-16-18(3,4)5/h7-16H2,1-6H3,(H,20,21) |
| InChIKey | MXLXLCSGUBATEL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|