C13H17NO — CID 129033929
1-(1-methylpyrrolidin-2-yl)-2-phenylethanone (PubChem CID 129033929) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-(1-methylpyrrolidin-2-yl)-2-phenylethanone.
| Compound Name | 1-(1-methylpyrrolidin-2-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 129033929 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-(1-methylpyrrolidin-2-yl)-2-phenylethanone |
| SMILES | CN1CCCC1C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H17NO/c1-14-9-5-8-12(14)13(15)10-11-6-3-2-4-7-11/h2-4,6-7,12H,5,8-10H2,1H3 |
| InChIKey | XVSKCGKREFMJED-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |