About (2R)-5,7-dihydroxy-2-methyl-2,3-dihydro-1H-quinolin-4-one
(2R)-5,7-dihydroxy-2-methyl-2,3-dihydro-1H-quinolin-4-one (PubChem CID 12903425) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is (2R)-5,7-dihydroxy-2-methyl-2,3-dihydro-1H-quinolin-4-one.
Molecular Properties
| Compound Name | (2R)-5,7-dihydroxy-2-methyl-2,3-dihydro-1H-quinolin-4-one |
| PubChem CID | 12903425 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (2R)-5,7-dihydroxy-2-methyl-2,3-dihydro-1H-quinolin-4-one |
| SMILES | C[C@@H]1CC(=O)c2c(O)cc(O)cc2N1 |
| InChI | InChI=1S/C10H11NO3/c1-5-2-8(13)10-7(11-5)3-6(12)4-9(10)14/h3-5,11-12,14H,2H2,1H3/t5-/m1/s1 |
| InChIKey | BNEPFPNDLPNULY-RXMQYKEDSA-N |
| XLogP | 1.48 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-5,7-dihydroxy-2-methyl-2,3-dihydro-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5,7-dihydroxy-2-methyl-2,3-dihydro-1H-quinolin-4-one?
The IUPAC name of (2R)-5,7-dihydroxy-2-methyl-2,3-dihydro-1H-quinolin-4-one (CID 12903425) is (2R)-5,7-dihydroxy-2-methyl-2,3-dihydro-1H-quinolin-4-one.
What is the SMILES notation for (2R)-5,7-dihydroxy-2-methyl-2,3-dihydro-1H-quinolin-4-one?
The canonical SMILES for (2R)-5,7-dihydroxy-2-methyl-2,3-dihydro-1H-quinolin-4-one is C[C@@H]1CC(=O)c2c(O)cc(O)cc2N1.
What is the InChIKey of (2R)-5,7-dihydroxy-2-methyl-2,3-dihydro-1H-quinolin-4-one?
The InChIKey is BNEPFPNDLPNULY-RXMQYKEDSA-N. The full InChI is InChI=1S/C10H11NO3/c1-5-2-8(13)10-7(11-5)3-6(12)4-9(10)14/h3-5,11-12,14H,2H2,1H3/t5-/m1/s1.
What are the key properties of (2R)-5,7-dihydroxy-2-methyl-2,3-dihydro-1H-quinolin-4-one?
(2R)-5,7-dihydroxy-2-methyl-2,3-dihydro-1H-quinolin-4-one has a molecular weight of 193.20 g/mol, XLogP of 1.48, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5,7-dihydroxy-2-methyl-2,3-dihydro-1H-quinolin-4-one is sourced from PubChem (CID 12903425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).