About N-(6-fluoro-3-methylhex-1-yn-3-yl)-1,1-diphenylmethanimine
N-(6-fluoro-3-methylhex-1-yn-3-yl)-1,1-diphenylmethanimine (PubChem CID 129034287) has the molecular formula C20H20FN
and a molecular weight of 293.39 g/mol. Its IUPAC name is N-(6-fluoro-3-methylhex-1-yn-3-yl)-1,1-diphenylmethanimine.
Molecular Properties
| Compound Name | N-(6-fluoro-3-methylhex-1-yn-3-yl)-1,1-diphenylmethanimine |
| PubChem CID | 129034287 |
| Molecular Formula | C20H20FN |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-(6-fluoro-3-methylhex-1-yn-3-yl)-1,1-diphenylmethanimine |
| SMILES | C#CC(C)(CCCF)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20FN/c1-3-20(2,15-10-16-21)22-19(17-11-6-4-7-12-17)18-13-8-5-9-14-18/h1,4-9,11-14H,10,15-16H2,2H3 |
| InChIKey | RSJUZNISSOLELA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(6-fluoro-3-methylhex-1-yn-3-yl)-1,1-diphenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-fluoro-3-methylhex-1-yn-3-yl)-1,1-diphenylmethanimine?
The IUPAC name of N-(6-fluoro-3-methylhex-1-yn-3-yl)-1,1-diphenylmethanimine (CID 129034287) is N-(6-fluoro-3-methylhex-1-yn-3-yl)-1,1-diphenylmethanimine.
What is the SMILES notation for N-(6-fluoro-3-methylhex-1-yn-3-yl)-1,1-diphenylmethanimine?
The canonical SMILES for N-(6-fluoro-3-methylhex-1-yn-3-yl)-1,1-diphenylmethanimine is C#CC(C)(CCCF)N=C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(6-fluoro-3-methylhex-1-yn-3-yl)-1,1-diphenylmethanimine?
The InChIKey is RSJUZNISSOLELA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20FN/c1-3-20(2,15-10-16-21)22-19(17-11-6-4-7-12-17)18-13-8-5-9-14-18/h1,4-9,11-14H,10,15-16H2,2H3.
What are the key properties of N-(6-fluoro-3-methylhex-1-yn-3-yl)-1,1-diphenylmethanimine?
N-(6-fluoro-3-methylhex-1-yn-3-yl)-1,1-diphenylmethanimine has a molecular weight of 293.39 g/mol, XLogP of 4.67, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-fluoro-3-methylhex-1-yn-3-yl)-1,1-diphenylmethanimine is sourced from PubChem (CID 129034287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).